C19H34BrNO3 — CID 11069493
[(E)-4-ethoxy-4-oxobut-2-enyl]-[(6E)-8-methoxy-2,6-dimethylocta-1,6-dien-3-yl]-dimethylazanium bromide (PubChem CID 11069493) has the molecular formula C19H34BrNO3 and a molecular weight of 404.39 g/mol. Its IUPAC name is [(E)-4-ethoxy-4-oxobut-2-enyl]-[(6E)-8-methoxy-2,6-dimethylocta-1,6-dien-3-yl]-dimethylazanium bromide.
| Compound Name | [(E)-4-ethoxy-4-oxobut-2-enyl]-[(6E)-8-methoxy-2,6-dimethylocta-1,6-dien-3-yl]-dimethylazanium bromide |
|---|---|
| PubChem CID | 11069493 |
| Molecular Formula | C19H34BrNO3 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | [(E)-4-ethoxy-4-oxobut-2-enyl]-[(6E)-8-methoxy-2,6-dimethylocta-1,6-dien-3-yl]-dimethylazanium bromide |
| SMILES | C=C(C)C(CC/C(C)=C/COC)[N+](C)(C)C/C=C/C(=O)OCC.[Br-] |
| InChI | InChI=1S/C19H34NO3.BrH/c1-8-23-19(21)10-9-14-20(5,6)18(16(2)3)12-11-17(4)13-15-22-7;/h9-10,13,18H,2,8,11-12,14-15H2,1,3-7H3;1H/q+1;/p-1/b10-9+,17-13+; |
| InChIKey | UTBGPATUWMLXLM-GVZHSVRPSA-M |
| XLogP | 0.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|