C26H31O2P — CID 11069523
(8S,8aS)-2-diphenylphosphoryl-5-methyl-8-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-one (PubChem CID 11069523) has the molecular formula C26H31O2P and a molecular weight of 406.51 g/mol. Its IUPAC name is (8S,8aS)-2-diphenylphosphoryl-5-methyl-8-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-one.
| Compound Name | (8S,8aS)-2-diphenylphosphoryl-5-methyl-8-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 11069523 |
| Molecular Formula | C26H31O2P |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (8S,8aS)-2-diphenylphosphoryl-5-methyl-8-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-one |
| SMILES | CC1=CC[C@@H](C(C)C)[C@@H]2C(=O)C(P(=O)(c3ccccc3)c3ccccc3)CCC12 |
| InChI | InChI=1S/C26H31O2P/c1-18(2)22-15-14-19(3)23-16-17-24(26(27)25(22)23)29(28,20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-14,18,22-25H,15-17H2,1-3H3/t22-,23?,24?,25-/m0/s1 |
| InChIKey | JISQKVOOUYVRSA-AATYUJHQSA-N |
| XLogP | 5.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|