About (4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone
(4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone (PubChem CID 110695913) has the molecular formula C9H13N3OS
and a molecular weight of 211.29 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone.
Molecular Properties
| Compound Name | (4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone |
| PubChem CID | 110695913 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone |
| SMILES | CN1CCN(C(=O)c2nccs2)CC1 |
| InChI | InChI=1S/C9H13N3OS/c1-11-3-5-12(6-4-11)9(13)8-10-2-7-14-8/h2,7H,3-6H2,1H3 |
| InChIKey | HRVKCIKPZUZXCV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone?
The IUPAC name of (4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone (CID 110695913) is (4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone.
What is the SMILES notation for (4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone?
The canonical SMILES for (4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone is CN1CCN(C(=O)c2nccs2)CC1.
What is the InChIKey of (4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone?
The InChIKey is HRVKCIKPZUZXCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3OS/c1-11-3-5-12(6-4-11)9(13)8-10-2-7-14-8/h2,7H,3-6H2,1H3.
What are the key properties of (4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone?
(4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone has a molecular weight of 211.29 g/mol, XLogP of 0.53, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylpiperazin-1-yl)-(1,3-thiazol-2-yl)methanone is sourced from PubChem (CID 110695913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).