About N,N-diethyl-1,3-thiazole-2-carboxamide
N,N-diethyl-1,3-thiazole-2-carboxamide (PubChem CID 110695970) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is N,N-diethyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 110695970 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | N,N-diethyl-1,3-thiazole-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1nccs1 |
| InChI | InChI=1S/C8H12N2OS/c1-3-10(4-2)8(11)7-9-5-6-12-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | BFBCPTUKJYJQKJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-1,3-thiazole-2-carboxamide?
The IUPAC name of N,N-diethyl-1,3-thiazole-2-carboxamide (CID 110695970) is N,N-diethyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N,N-diethyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for N,N-diethyl-1,3-thiazole-2-carboxamide is CCN(CC)C(=O)c1nccs1.
What is the InChIKey of N,N-diethyl-1,3-thiazole-2-carboxamide?
The InChIKey is BFBCPTUKJYJQKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-3-10(4-2)8(11)7-9-5-6-12-7/h5-6H,3-4H2,1-2H3.
What are the key properties of N,N-diethyl-1,3-thiazole-2-carboxamide?
N,N-diethyl-1,3-thiazole-2-carboxamide has a molecular weight of 184.26 g/mol, XLogP of 1.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 110695970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).