C25H22N4O2 — CID 11069607
2-amino-N-[(11R)-6-methyl-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]benzamide (PubChem CID 11069607) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 2-amino-N-[(11R)-6-methyl-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]benzamide.
| Compound Name | 2-amino-N-[(11R)-6-methyl-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]benzamide |
|---|---|
| PubChem CID | 11069607 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-amino-N-[(11R)-6-methyl-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]benzamide |
| SMILES | Cc1cc2c3c(c1)C(c1ccccc1)=N[C@@H](NC(=O)c1ccccc1N)C(=O)N3CC2 |
| InChI | InChI=1S/C25H22N4O2/c1-15-13-17-11-12-29-22(17)19(14-15)21(16-7-3-2-4-8-16)27-23(25(29)31)28-24(30)18-9-5-6-10-20(18)26/h2-10,13-14,23H,11-12,26H2,1H3,(H,28,30)/t23-/m0/s1 |
| InChIKey | CNRHLSYLZOPCPE-QHCPKHFHSA-N |
| XLogP | 3.07 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|