C8H12N2OS — CID 110696075
4-methyl-N-propyl-1,3-thiazole-2-carboxamide (PubChem CID 110696075) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is 4-methyl-N-propyl-1,3-thiazole-2-carboxamide.
| Compound Name | 4-methyl-N-propyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 110696075 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4-methyl-N-propyl-1,3-thiazole-2-carboxamide |
| SMILES | CCCNC(=O)c1nc(C)cs1 |
| InChI | InChI=1S/C8H12N2OS/c1-3-4-9-7(11)8-10-6(2)5-12-8/h5H,3-4H2,1-2H3,(H,9,11) |
| InChIKey | SIBZRFUJWJFAST-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |