C12H10O4S6 — CID 11069623
dimethyl 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 11069623) has the molecular formula C12H10O4S6 and a molecular weight of 410.61 g/mol. Its IUPAC name is dimethyl 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11069623 |
| Molecular Formula | C12H10O4S6 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 409.89 |
| IUPAC Name | dimethyl 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2SC3=C(SCCS3)S2)S1 |
| InChI | InChI=1S/C12H10O4S6/c1-15-7(13)5-6(8(14)16-2)20-11(19-5)12-21-9-10(22-12)18-4-3-17-9/h3-4H2,1-2H3 |
| InChIKey | PRYZLYGYNZXAOF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |