C15H18N2OS — CID 110696304
N-benzyl-N-ethyl-4,5-dimethyl-1,3-thiazole-2-carboxamide (PubChem CID 110696304) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is N-benzyl-N-ethyl-4,5-dimethyl-1,3-thiazole-2-carboxamide.
| Compound Name | N-benzyl-N-ethyl-4,5-dimethyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 110696304 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N-benzyl-N-ethyl-4,5-dimethyl-1,3-thiazole-2-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1nc(C)c(C)s1 |
| InChI | InChI=1S/C15H18N2OS/c1-4-17(10-13-8-6-5-7-9-13)15(18)14-16-11(2)12(3)19-14/h5-9H,4,10H2,1-3H3 |
| InChIKey | MZLWAKPHIBLXNK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |