About CID 11069704
CID 11069704 (PubChem CID 11069704) has the molecular formula C24H35CoO2
and a molecular weight of 414.48 g/mol.
Molecular Properties
| Compound Name | CID 11069704 |
| PubChem CID | 11069704 |
| Molecular Formula | C24H35CoO2 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | — |
| SMILES | C/C=C/C1=C(C(C)(C)C)CC2(C=C1C)COC(C)(C)OC2.[CH]1C=CC=C1.[Co] |
| InChI | InChI=1S/C19H30O2.C5H5.Co/c1-8-9-15-14(2)10-19(11-16(15)17(3,4)5)12-20-18(6,7)21-13-19;1-2-4-5-3-1;/h8-10H,11-13H2,1-7H3;1-5H;/b9-8+;; |
| InChIKey | IRQXFZRMUHQAAT-YEUQMBKVSA-N |
| XLogP | 6.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 11069704 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11069704?
The IUPAC name of CID 11069704 (CID 11069704) is not available.
What is the SMILES notation for CID 11069704?
The canonical SMILES for CID 11069704 is C/C=C/C1=C(C(C)(C)C)CC2(C=C1C)COC(C)(C)OC2.[CH]1C=CC=C1.[Co].
What is the InChIKey of CID 11069704?
The InChIKey is IRQXFZRMUHQAAT-YEUQMBKVSA-N. The full InChI is InChI=1S/C19H30O2.C5H5.Co/c1-8-9-15-14(2)10-19(11-16(15)17(3,4)5)12-20-18(6,7)21-13-19;1-2-4-5-3-1;/h8-10H,11-13H2,1-7H3;1-5H;/b9-8+;;.
What are the key properties of CID 11069704?
CID 11069704 has a molecular weight of 414.48 g/mol, XLogP of 6.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11069704 is sourced from PubChem (CID 11069704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).