C22H46O3Si2 — CID 11069715
(E,2S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-triethylsilyloxyhept-3-enal (PubChem CID 11069715) has the molecular formula C22H46O3Si2 and a molecular weight of 414.78 g/mol. Its IUPAC name is (E,2S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-triethylsilyloxyhept-3-enal.
| Compound Name | (E,2S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-triethylsilyloxyhept-3-enal |
|---|---|
| PubChem CID | 11069715 |
| Molecular Formula | C22H46O3Si2 |
| Molecular Weight | 414.78 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (E,2S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-triethylsilyloxyhept-3-enal |
| SMILES | CC[Si](CC)(CC)OC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](C)C=O |
| InChI | InChI=1S/C22H46O3Si2/c1-12-27(13-2,14-3)24-17-20(6)21(19(5)15-18(4)16-23)25-26(10,11)22(7,8)9/h15-16,18,20-21H,12-14,17H2,1-11H3/b19-15+/t18-,20-,21-/m0/s1 |
| InChIKey | IEQYUZMONCPTGZ-RQJFYKIPSA-N |
| XLogP | 6.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.78 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|