C27H29NO3 — CID 11069733
(4S)-3-[(1R,2R,3S,4S)-3-methylbicyclo[2.2.1]hept-5-ene-2-carbonyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 11069733) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is (4S)-3-[(1R,2R,3S,4S)-3-methylbicyclo[2.2.1]hept-5-ene-2-carbonyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(1R,2R,3S,4S)-3-methylbicyclo[2.2.1]hept-5-ene-2-carbonyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11069733 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (4S)-3-[(1R,2R,3S,4S)-3-methylbicyclo[2.2.1]hept-5-ene-2-carbonyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@@H]1N(C(=O)[C@@H]2[C@@H](C)[C@@H]3C=C[C@H]2C3)C(=O)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29NO3/c1-17(2)24-27(21-10-6-4-7-11-21,22-12-8-5-9-13-22)31-26(30)28(24)25(29)23-18(3)19-14-15-20(23)16-19/h4-15,17-20,23-24H,16H2,1-3H3/t18-,19+,20-,23+,24-/m0/s1 |
| InChIKey | DTGJLRGZGSCIEA-ICWLXMKVSA-N |
| XLogP | 5.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|