C24H32O6 — CID 11069750
[(3aR,6E,8S,10E,12S,14E,15aS)-12-acetyloxy-6,10,14-trimethyl-3-methylidene-2-oxo-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-8-yl] acetate (PubChem CID 11069750) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is [(3aR,6E,8S,10E,12S,14E,15aS)-12-acetyloxy-6,10,14-trimethyl-3-methylidene-2-oxo-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-8-yl] acetate.
| Compound Name | [(3aR,6E,8S,10E,12S,14E,15aS)-12-acetyloxy-6,10,14-trimethyl-3-methylidene-2-oxo-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-8-yl] acetate |
|---|---|
| PubChem CID | 11069750 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [(3aR,6E,8S,10E,12S,14E,15aS)-12-acetyloxy-6,10,14-trimethyl-3-methylidene-2-oxo-3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-8-yl] acetate |
| SMILES | C=C1C(=O)O[C@H]2/C=C(\C)C[C@H](OC(C)=O)/C=C(\C)C[C@H](OC(C)=O)/C=C(\C)CC[C@H]12 |
| InChI | InChI=1S/C24H32O6/c1-14-7-8-22-17(4)24(27)30-23(22)13-16(3)12-21(29-19(6)26)11-15(2)10-20(9-14)28-18(5)25/h9,11,13,20-23H,4,7-8,10,12H2,1-3,5-6H3/b14-9+,15-11+,16-13+/t20-,21-,22-,23+/m1/s1 |
| InChIKey | DLHXLPYBWGMTLH-FMBDEMQVSA-N |
| XLogP | 4.36 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|