C16H23NO3S — CID 110698415
ethyl 1-(2-methyl-2-thiophen-2-ylpropanoyl)piperidine-3-carboxylate (PubChem CID 110698415) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is ethyl 1-(2-methyl-2-thiophen-2-ylpropanoyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(2-methyl-2-thiophen-2-ylpropanoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110698415 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | ethyl 1-(2-methyl-2-thiophen-2-ylpropanoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)C(C)(C)c2cccs2)C1 |
| InChI | InChI=1S/C16H23NO3S/c1-4-20-14(18)12-7-5-9-17(11-12)15(19)16(2,3)13-8-6-10-21-13/h6,8,10,12H,4-5,7,9,11H2,1-3H3 |
| InChIKey | CHZHPUHLDWUCSC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |