C24H46O4Si — CID 11069954
(E,3R,8R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,8-trimethyl-6-methylidenenon-4-en-1-ol (PubChem CID 11069954) has the molecular formula C24H46O4Si and a molecular weight of 426.71 g/mol. Its IUPAC name is (E,3R,8R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,8-trimethyl-6-methylidenenon-4-en-1-ol.
| Compound Name | (E,3R,8R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,8-trimethyl-6-methylidenenon-4-en-1-ol |
|---|---|
| PubChem CID | 11069954 |
| Molecular Formula | C24H46O4Si |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | (E,3R,8R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,8-trimethyl-6-methylidenenon-4-en-1-ol |
| SMILES | C=C(/C=C(\C)[C@@](C)(CCO)O[Si](C)(C)C(C)(C)C)C[C@@H](C)C[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C24H46O4Si/c1-18(14-19(2)16-21-17-26-23(7,8)27-21)15-20(3)24(9,12-13-25)28-29(10,11)22(4,5)6/h15,19,21,25H,1,12-14,16-17H2,2-11H3/b20-15+/t19-,21-,24-/m1/s1 |
| InChIKey | DIBDPGAPUVECKZ-NRGPSOEZSA-N |
| XLogP | 6.22 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|