About 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide
2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide (PubChem CID 110700060) has the molecular formula C12H19N3O3
and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide.
Molecular Properties
| Compound Name | 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide |
| PubChem CID | 110700060 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)Cc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C12H19N3O3/c1-3-5-15(6-4-2)11(17)8-9-7-10(16)14-12(18)13-9/h7H,3-6,8H2,1-2H3,(H2,13,14,16,18) |
| InChIKey | LPCGPDFKCPRMPW-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide?
The IUPAC name of 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide (CID 110700060) is 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide.
What is the SMILES notation for 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide?
The canonical SMILES for 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide is CCCN(CCC)C(=O)Cc1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide?
The InChIKey is LPCGPDFKCPRMPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3/c1-3-5-15(6-4-2)11(17)8-9-7-10(16)14-12(18)13-9/h7H,3-6,8H2,1-2H3,(H2,13,14,16,18).
What are the key properties of 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide?
2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide has a molecular weight of 253.30 g/mol, XLogP of 0.25, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N,N-dipropylacetamide is sourced from PubChem (CID 110700060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).