C20H35NO7Si — CID 11070008
tert-butyl (3aS,6R,6aS)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 11070008) has the molecular formula C20H35NO7Si and a molecular weight of 429.59 g/mol. Its IUPAC name is tert-butyl (3aS,6R,6aS)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,6R,6aS)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 11070008 |
| Molecular Formula | C20H35NO7Si |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | tert-butyl (3aS,6R,6aS)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@H]2OC(C)(C)O[C@H]2[C@@H]1[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H35NO7Si/c1-18(2,3)27-17(24)21-13(12(11-22)28-29(9,10)19(4,5)6)14-15(16(21)23)26-20(7,8)25-14/h11-15H,1-10H3/t12-,13+,14+,15+/m1/s1 |
| InChIKey | YHWWKTQGGMBXLI-QPSCCSFWSA-N |
| XLogP | 3.24 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|