C16H15N3O2 — CID 110700925
N-(2-ethoxyphenyl)-1H-benzimidazole-4-carboxamide (PubChem CID 110700925) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-1H-benzimidazole-4-carboxamide.
| Compound Name | N-(2-ethoxyphenyl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 110700925 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(2-ethoxyphenyl)-1H-benzimidazole-4-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)c1cccc2[nH]cnc12 |
| InChI | InChI=1S/C16H15N3O2/c1-2-21-14-9-4-3-7-12(14)19-16(20)11-6-5-8-13-15(11)18-10-17-13/h3-10H,2H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | PVYOPZUIJDRVNQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |