C23H36N2O6 — CID 11070163
2-[[(1S,3aS,5S,7aR)-3a-hydroxy-7a-methyl-5-phenyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]methylamino]oxyethyl-dimethylazanium;2-hydroxy-2-oxoacetate (PubChem CID 11070163) has the molecular formula C23H36N2O6 and a molecular weight of 436.55 g/mol. Its IUPAC name is 2-[[(1S,3aS,5S,7aR)-3a-hydroxy-7a-methyl-5-phenyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]methylamino]oxyethyl-dimethylazanium;2-hydroxy-2-oxoacetate.
| Compound Name | 2-[[(1S,3aS,5S,7aR)-3a-hydroxy-7a-methyl-5-phenyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]methylamino]oxyethyl-dimethylazanium;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 11070163 |
| Molecular Formula | C23H36N2O6 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 2-[[(1S,3aS,5S,7aR)-3a-hydroxy-7a-methyl-5-phenyl-2,3,4,5,6,7-hexahydro-1H-inden-1-yl]methylamino]oxyethyl-dimethylazanium;2-hydroxy-2-oxoacetate |
| SMILES | C[NH+](C)CCONC[C@H]1CC[C@]2(O)C[C@@H](c3ccccc3)CC[C@]12C.O=C([O-])C(=O)O |
| InChI | InChI=1S/C21H34N2O2.C2H2O4/c1-20-11-9-18(17-7-5-4-6-8-17)15-21(20,24)12-10-19(20)16-22-25-14-13-23(2)3;3-1(4)2(5)6/h4-8,18-19,22,24H,9-16H2,1-3H3;(H,3,4)(H,5,6)/t18-,19+,20+,21-;/m0./s1 |
| InChIKey | FXSXFXJQAHMAQB-DEUCCPJSSA-N |
| XLogP | -0.41 |
| TPSA | 123.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|