C25H44O4Si — CID 11070174
ethyl (2E,4E,6R,7S,8S,10E)-2,4,6,8,10-pentamethyl-12-oxo-7-triethylsilyloxydodeca-2,4,10-trienoate (PubChem CID 11070174) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is ethyl (2E,4E,6R,7S,8S,10E)-2,4,6,8,10-pentamethyl-12-oxo-7-triethylsilyloxydodeca-2,4,10-trienoate.
| Compound Name | ethyl (2E,4E,6R,7S,8S,10E)-2,4,6,8,10-pentamethyl-12-oxo-7-triethylsilyloxydodeca-2,4,10-trienoate |
|---|---|
| PubChem CID | 11070174 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | ethyl (2E,4E,6R,7S,8S,10E)-2,4,6,8,10-pentamethyl-12-oxo-7-triethylsilyloxydodeca-2,4,10-trienoate |
| SMILES | CCOC(=O)/C(C)=C/C(C)=C/[C@@H](C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)C/C(C)=C/C=O |
| InChI | InChI=1S/C25H44O4Si/c1-10-28-25(27)23(9)18-20(6)17-22(8)24(21(7)16-19(5)14-15-26)29-30(11-2,12-3)13-4/h14-15,17-18,21-22,24H,10-13,16H2,1-9H3/b19-14+,20-17+,23-18+/t21-,22+,24-/m0/s1 |
| InChIKey | HDLJPSVEYOJODL-WNSAEVTPSA-N |
| XLogP | 6.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|