C14H13N5O3 — CID 110702006
N-[2-(1H-indol-3-yl)ethyl]-3,5-dioxo-2H-1,2,4-triazine-6-carboxamide (PubChem CID 110702006) has the molecular formula C14H13N5O3 and a molecular weight of 299.29 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-3,5-dioxo-2H-1,2,4-triazine-6-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-3,5-dioxo-2H-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 110702006 |
| Molecular Formula | C14H13N5O3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-3,5-dioxo-2H-1,2,4-triazine-6-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)c1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H13N5O3/c20-12(11-13(21)17-14(22)19-18-11)15-6-5-8-7-16-10-4-2-1-3-9(8)10/h1-4,7,16H,5-6H2,(H,15,20)(H2,17,19,21,22) |
| InChIKey | LHIUMMJNHFLGES-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |