About 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate
2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate (PubChem CID 11070211) has the molecular formula C25H22BF4NO
and a molecular weight of 439.26 g/mol. Its IUPAC name is 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate.
Molecular Properties
| Compound Name | 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate |
| PubChem CID | 11070211 |
| Molecular Formula | C25H22BF4NO |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate |
| SMILES | F[B-](F)(F)F.OCC[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C25H22NO.BF4/c27-17-16-26-24(21-12-6-2-7-13-21)18-23(20-10-4-1-5-11-20)19-25(26)22-14-8-3-9-15-22;2-1(3,4)5/h1-15,18-19,27H,16-17H2;/q+1;-1 |
| InChIKey | HEOPNSIFGMFMFV-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate?
The IUPAC name of 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate (CID 11070211) is 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate.
What is the SMILES notation for 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate?
The canonical SMILES for 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate is F[B-](F)(F)F.OCC[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.
What is the InChIKey of 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate?
The InChIKey is HEOPNSIFGMFMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22NO.BF4/c27-17-16-26-24(21-12-6-2-7-13-21)18-23(20-10-4-1-5-11-20)19-25(26)22-14-8-3-9-15-22;2-1(3,4)5/h1-15,18-19,27H,16-17H2;/q+1;-1.
What are the key properties of 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate?
2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate has a molecular weight of 439.26 g/mol, XLogP of 6.27, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethanol tetrafluoroborate is sourced from PubChem (CID 11070211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).