C9H12N2O2 — CID 110702148
(2-methyl-1,3-oxazol-5-yl)-pyrrolidin-1-ylmethanone (PubChem CID 110702148) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (2-methyl-1,3-oxazol-5-yl)-pyrrolidin-1-ylmethanone.
| Compound Name | (2-methyl-1,3-oxazol-5-yl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 110702148 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (2-methyl-1,3-oxazol-5-yl)-pyrrolidin-1-ylmethanone |
| SMILES | Cc1ncc(C(=O)N2CCCC2)o1 |
| InChI | InChI=1S/C9H12N2O2/c1-7-10-6-8(13-7)9(12)11-4-2-3-5-11/h6H,2-5H2,1H3 |
| InChIKey | WZSDPZKOZISLGG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |