C18H17NO4 — CID 110703181
N-(2,4-dimethoxyphenyl)-2-methyl-1-benzofuran-3-carboxamide (PubChem CID 110703181) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-methyl-1-benzofuran-3-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 110703181 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-methyl-1-benzofuran-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c(C)oc3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C18H17NO4/c1-11-17(13-6-4-5-7-15(13)23-11)18(20)19-14-9-8-12(21-2)10-16(14)22-3/h4-10H,1-3H3,(H,19,20) |
| InChIKey | UZSSGBHECDZJRD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |