C19H19N3O3 — CID 110703786
N-benzyl-3-(3,5-dioxopyrazolidin-4-yl)-N-phenylpropanamide (PubChem CID 110703786) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-benzyl-3-(3,5-dioxopyrazolidin-4-yl)-N-phenylpropanamide.
| Compound Name | N-benzyl-3-(3,5-dioxopyrazolidin-4-yl)-N-phenylpropanamide |
|---|---|
| PubChem CID | 110703786 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-benzyl-3-(3,5-dioxopyrazolidin-4-yl)-N-phenylpropanamide |
| SMILES | O=C1NNC(=O)C1CCC(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O3/c23-17(12-11-16-18(24)20-21-19(16)25)22(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-10,16H,11-13H2,(H,20,24)(H,21,25) |
| InChIKey | UCJYVMLOULQLIB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|