About 1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one
1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one (PubChem CID 1107047) has the molecular formula C17H13Cl2NO3
and a molecular weight of 350.20 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one.
Molecular Properties
| Compound Name | 1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one |
| PubChem CID | 1107047 |
| Molecular Formula | C17H13Cl2NO3 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one |
| SMILES | O=C1CCN(C(=O)COc2ccc(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C17H13Cl2NO3/c18-11-5-6-16(13(19)9-11)23-10-17(22)20-8-7-15(21)12-3-1-2-4-14(12)20/h1-6,9H,7-8,10H2 |
| InChIKey | AFEJNDGPXMJNJU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one?
The IUPAC name of 1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one (CID 1107047) is 1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one.
What is the SMILES notation for 1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one?
The canonical SMILES for 1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one is O=C1CCN(C(=O)COc2ccc(Cl)cc2Cl)c2ccccc21.
What is the InChIKey of 1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one?
The InChIKey is AFEJNDGPXMJNJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl2NO3/c18-11-5-6-16(13(19)9-11)23-10-17(22)20-8-7-15(21)12-3-1-2-4-14(12)20/h1-6,9H,7-8,10H2.
What are the key properties of 1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one?
1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one has a molecular weight of 350.20 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,4-dichlorophenoxy)acetyl]-2,3-dihydroquinolin-4-one is sourced from PubChem (CID 1107047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).