C11H16N2O3S — CID 110706005
N-(3-methylphenyl)morpholine-4-sulfonamide (PubChem CID 110706005) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-(3-methylphenyl)morpholine-4-sulfonamide.
| Compound Name | N-(3-methylphenyl)morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 110706005 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-(3-methylphenyl)morpholine-4-sulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C11H16N2O3S/c1-10-3-2-4-11(9-10)12-17(14,15)13-5-7-16-8-6-13/h2-4,9,12H,5-8H2,1H3 |
| InChIKey | XUWOSVBPJRZKGD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |