C13H23N3O4 — CID 110706653
ethyl 4-(oxolan-2-ylcarbamoylamino)piperidine-1-carboxylate (PubChem CID 110706653) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is ethyl 4-(oxolan-2-ylcarbamoylamino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(oxolan-2-ylcarbamoylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110706653 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | ethyl 4-(oxolan-2-ylcarbamoylamino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)NC2CCCO2)CC1 |
| InChI | InChI=1S/C13H23N3O4/c1-2-19-13(18)16-7-5-10(6-8-16)14-12(17)15-11-4-3-9-20-11/h10-11H,2-9H2,1H3,(H2,14,15,17) |
| InChIKey | YPNDQCYNIITDSP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |