C25H46O6Si — CID 11070714
tert-butyl-[(2R,3S,5S,6R)-6-[(E,2S)-4-[(2S,3S,6R)-3,6-dimethoxy-3,6-dihydro-2H-pyran-2-yl]pent-3-en-2-yl]-5-methoxy-3-methyloxan-2-yl]oxy-dimethylsilane (PubChem CID 11070714) has the molecular formula C25H46O6Si and a molecular weight of 470.72 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,5S,6R)-6-[(E,2S)-4-[(2S,3S,6R)-3,6-dimethoxy-3,6-dihydro-2H-pyran-2-yl]pent-3-en-2-yl]-5-methoxy-3-methyloxan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S,5S,6R)-6-[(E,2S)-4-[(2S,3S,6R)-3,6-dimethoxy-3,6-dihydro-2H-pyran-2-yl]pent-3-en-2-yl]-5-methoxy-3-methyloxan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11070714 |
| Molecular Formula | C25H46O6Si |
| Molecular Weight | 470.72 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | tert-butyl-[(2R,3S,5S,6R)-6-[(E,2S)-4-[(2S,3S,6R)-3,6-dimethoxy-3,6-dihydro-2H-pyran-2-yl]pent-3-en-2-yl]-5-methoxy-3-methyloxan-2-yl]oxy-dimethylsilane |
| SMILES | CO[C@H]1C=C[C@H](OC)[C@H](/C(C)=C/[C@H](C)[C@H]2O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H]2OC)O1 |
| InChI | InChI=1S/C25H46O6Si/c1-16(22-19(26-7)12-13-21(28-9)29-22)14-17(2)23-20(27-8)15-18(3)24(30-23)31-32(10,11)25(4,5)6/h12-14,17-24H,15H2,1-11H3/b16-14+/t17-,18-,19-,20-,21+,22-,23+,24+/m0/s1 |
| InChIKey | XMUJWAKEUCDAMR-LDXUWZLGSA-N |
| XLogP | 5.30 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.72 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|