About N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide
N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide (PubChem CID 110707156) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide |
| PubChem CID | 110707156 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCN1CCOC1=O |
| InChI | InChI=1S/C7H12N2O3/c1-6(10)8-2-3-9-4-5-12-7(9)11/h2-5H2,1H3,(H,8,10) |
| InChIKey | KRYHIVBCKGGRRH-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide?
The IUPAC name of N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide (CID 110707156) is N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide.
What is the SMILES notation for N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide?
The canonical SMILES for N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide is CC(=O)NCCN1CCOC1=O.
What is the InChIKey of N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide?
The InChIKey is KRYHIVBCKGGRRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3/c1-6(10)8-2-3-9-4-5-12-7(9)11/h2-5H2,1H3,(H,8,10).
What are the key properties of N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide?
N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide has a molecular weight of 172.18 g/mol, XLogP of -0.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]acetamide is sourced from PubChem (CID 110707156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).