About 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide
2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide (PubChem CID 110707159) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide.
Molecular Properties
| Compound Name | 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide |
| PubChem CID | 110707159 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide |
| SMILES | CC(C)C(=O)NCCN1CCOC1=O |
| InChI | InChI=1S/C9H16N2O3/c1-7(2)8(12)10-3-4-11-5-6-14-9(11)13/h7H,3-6H2,1-2H3,(H,10,12) |
| InChIKey | TXOLKHRPPYRJDY-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide?
The IUPAC name of 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide (CID 110707159) is 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide.
What is the SMILES notation for 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide?
The canonical SMILES for 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide is CC(C)C(=O)NCCN1CCOC1=O.
What is the InChIKey of 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide?
The InChIKey is TXOLKHRPPYRJDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-7(2)8(12)10-3-4-11-5-6-14-9(11)13/h7H,3-6H2,1-2H3,(H,10,12).
What are the key properties of 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide?
2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide has a molecular weight of 200.24 g/mol, XLogP of 0.21, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]propanamide is sourced from PubChem (CID 110707159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).