C12H13ClN2O3 — CID 110707207
2-chloro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]benzamide (PubChem CID 110707207) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110707207 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-chloro-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]benzamide |
| SMILES | O=C(NCCN1CCOC1=O)c1ccccc1Cl |
| InChI | InChI=1S/C12H13ClN2O3/c13-10-4-2-1-3-9(10)11(16)14-5-6-15-7-8-18-12(15)17/h1-4H,5-8H2,(H,14,16) |
| InChIKey | JXSDYXGGABHLPK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |