C29H58N4O — CID 11070846
2,2-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-N-[6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]propanamide (PubChem CID 11070846) has the molecular formula C29H58N4O and a molecular weight of 478.81 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-N-[6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]propanamide.
| Compound Name | 2,2-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-N-[6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]propanamide |
|---|---|
| PubChem CID | 11070846 |
| Molecular Formula | C29H58N4O |
| Molecular Weight | 478.81 g/mol |
| Exact Mass | 478.46 |
| IUPAC Name | 2,2-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-N-[6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]propanamide |
| SMILES | CC1(C)CC(NCCCCCCN(C(=O)C(C)(C)C)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C29H58N4O/c1-25(2,3)24(34)33(23-20-28(8,9)32-29(10,11)21-23)17-15-13-12-14-16-30-22-18-26(4,5)31-27(6,7)19-22/h22-23,30-32H,12-21H2,1-11H3 |
| InChIKey | AJPOBPBABKDFFB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.81 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|