About 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide
2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 1107087) has the molecular formula C14H13Cl2N3O4S2
and a molecular weight of 422.32 g/mol. Its IUPAC name is 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 1107087 |
| Molecular Formula | C14H13Cl2N3O4S2 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2N3O4S2/c15-10-8-11(16)12(25(21,22)19-2-4-23-5-3-19)7-9(10)13(20)18-14-17-1-6-24-14/h1,6-8H,2-5H2,(H,17,18,20) |
| InChIKey | SYPVSDULPPCGLN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide (CID 1107087) is 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide is O=C(Nc1nccs1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl.
What is the InChIKey of 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide?
The InChIKey is SYPVSDULPPCGLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2N3O4S2/c15-10-8-11(16)12(25(21,22)19-2-4-23-5-3-19)7-9(10)13(20)18-14-17-1-6-24-14/h1,6-8H,2-5H2,(H,17,18,20).
What are the key properties of 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide?
2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide has a molecular weight of 422.32 g/mol, XLogP of 2.72, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 1107087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).