C12H18N2O3S — CID 110709650
4-hydroxy-N,N,4-trimethyl-2,3-dihydroquinoline-1-sulfonamide (PubChem CID 110709650) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-hydroxy-N,N,4-trimethyl-2,3-dihydroquinoline-1-sulfonamide.
| Compound Name | 4-hydroxy-N,N,4-trimethyl-2,3-dihydroquinoline-1-sulfonamide |
|---|---|
| PubChem CID | 110709650 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-hydroxy-N,N,4-trimethyl-2,3-dihydroquinoline-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC(C)(O)c2ccccc21 |
| InChI | InChI=1S/C12H18N2O3S/c1-12(15)8-9-14(18(16,17)13(2)3)11-7-5-4-6-10(11)12/h4-7,15H,8-9H2,1-3H3 |
| InChIKey | XEJLYGDYWNGDDU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |