C17H26N2O2 — CID 110709813
2,2-dimethyl-N-[2-(4-phenylmorpholin-2-yl)ethyl]propanamide (PubChem CID 110709813) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-(4-phenylmorpholin-2-yl)ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-(4-phenylmorpholin-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 110709813 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2,2-dimethyl-N-[2-(4-phenylmorpholin-2-yl)ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCCC1CN(c2ccccc2)CCO1 |
| InChI | InChI=1S/C17H26N2O2/c1-17(2,3)16(20)18-10-9-15-13-19(11-12-21-15)14-7-5-4-6-8-14/h4-8,15H,9-13H2,1-3H3,(H,18,20) |
| InChIKey | GSYZSPRAZZVHJQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |