About [1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane
[1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane (PubChem CID 11071017) has the molecular formula C28H34O4Si2
and a molecular weight of 490.75 g/mol. Its IUPAC name is [1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane.
Molecular Properties
| Compound Name | [1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane |
| PubChem CID | 11071017 |
| Molecular Formula | C28H34O4Si2 |
| Molecular Weight | 490.75 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | [1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(c1ccccc1)(c1ccco1)C(O[Si](C)(C)C)(c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C28H34O4Si2/c1-33(2,3)31-27(25-19-13-21-29-25,23-15-9-7-10-16-23)28(32-34(4,5)6,26-20-14-22-30-26)24-17-11-8-12-18-24/h7-22H,1-6H3 |
| InChIKey | VVRHWXCIYUWVFY-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 44.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.75 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane?
The IUPAC name of [1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane (CID 11071017) is [1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane.
What is the SMILES notation for [1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane?
The canonical SMILES for [1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane is C[Si](C)(C)OC(c1ccccc1)(c1ccco1)C(O[Si](C)(C)C)(c1ccccc1)c1ccco1.
What is the InChIKey of [1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane?
The InChIKey is VVRHWXCIYUWVFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34O4Si2/c1-33(2,3)31-27(25-19-13-21-29-25,23-15-9-7-10-16-23)28(32-34(4,5)6,26-20-14-22-30-26)24-17-11-8-12-18-24/h7-22H,1-6H3.
What are the key properties of [1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane?
[1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane has a molecular weight of 490.75 g/mol, XLogP of 7.76, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2-bis(furan-2-yl)-1,2-diphenyl-2-trimethylsilyloxyethoxy]-trimethylsilane is sourced from PubChem (CID 11071017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).