C15H14F3N3OS — CID 110710921
[4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 110710921) has the molecular formula C15H14F3N3OS and a molecular weight of 341.36 g/mol. Its IUPAC name is [4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 110710921 |
| Molecular Formula | C15H14F3N3OS |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | [4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | Cc1csc(N2CCN(C(=O)c3ccc(F)c(F)c3F)CC2)n1 |
| InChI | InChI=1S/C15H14F3N3OS/c1-9-8-23-15(19-9)21-6-4-20(5-7-21)14(22)10-2-3-11(16)13(18)12(10)17/h2-3,8H,4-7H2,1H3 |
| InChIKey | LENHHSNOKJKYTG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|