C14H20N2O4S — CID 110712399
3,4-dimethyl-N-(2-morpholin-4-yl-2-oxoethyl)benzenesulfonamide (PubChem CID 110712399) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3,4-dimethyl-N-(2-morpholin-4-yl-2-oxoethyl)benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-(2-morpholin-4-yl-2-oxoethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110712399 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3,4-dimethyl-N-(2-morpholin-4-yl-2-oxoethyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)N2CCOCC2)cc1C |
| InChI | InChI=1S/C14H20N2O4S/c1-11-3-4-13(9-12(11)2)21(18,19)15-10-14(17)16-5-7-20-8-6-16/h3-4,9,15H,5-8,10H2,1-2H3 |
| InChIKey | DNTXPFOPYRVRFS-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |