C13H15N3O3S — CID 110712533
2-cyano-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzenesulfonamide (PubChem CID 110712533) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-cyano-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzenesulfonamide.
| Compound Name | 2-cyano-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110712533 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-cyano-N-(2-oxo-2-pyrrolidin-1-ylethyl)benzenesulfonamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)NCC(=O)N1CCCC1 |
| InChI | InChI=1S/C13H15N3O3S/c14-9-11-5-1-2-6-12(11)20(18,19)15-10-13(17)16-7-3-4-8-16/h1-2,5-6,15H,3-4,7-8,10H2 |
| InChIKey | XMRIIOCMWOVKGJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |