C17H20N2O — CID 110713731
3,3-dimethyl-N-(5-phenyl-3-pyridinyl)butanamide (PubChem CID 110713731) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 3,3-dimethyl-N-(5-phenyl-3-pyridinyl)butanamide.
| Compound Name | 3,3-dimethyl-N-(5-phenyl-3-pyridinyl)butanamide |
|---|---|
| PubChem CID | 110713731 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3,3-dimethyl-N-(5-phenyl-3-pyridinyl)butanamide |
| SMILES | CC(C)(C)CC(=O)Nc1cncc(-c2ccccc2)c1 |
| InChI | InChI=1S/C17H20N2O/c1-17(2,3)10-16(20)19-15-9-14(11-18-12-15)13-7-5-4-6-8-13/h4-9,11-12H,10H2,1-3H3,(H,19,20) |
| InChIKey | WWRLJRJZVROLLA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |