C29H46O6Si — CID 11071390
(1S,5S,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicosa-6,17-dien-3-one (PubChem CID 11071390) has the molecular formula C29H46O6Si and a molecular weight of 518.77 g/mol. Its IUPAC name is (1S,5S,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicosa-6,17-dien-3-one.
| Compound Name | (1S,5S,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicosa-6,17-dien-3-one |
|---|---|
| PubChem CID | 11071390 |
| Molecular Formula | C29H46O6Si |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | (1S,5S,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicosa-6,17-dien-3-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@]23OC(=O)O[C@H]2C2=CCCC[C@@]2(C)[C@H]2OC(C)(C)O[C@@H]2C(=C1C)C3(C)C |
| InChI | InChI=1S/C29H46O6Si/c1-10-36(11-2,12-3)35-20-17-29-23(31-25(30)34-29)19-15-13-14-16-28(19,9)24-22(32-27(7,8)33-24)21(18(20)4)26(29,5)6/h15,20,22-24H,10-14,16-17H2,1-9H3/t20-,22+,23-,24-,28+,29+/m0/s1 |
| InChIKey | OXGSLECERHTOBT-SOZQJQGRSA-N |
| XLogP | 7.05 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|