About (5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone
(5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone (PubChem CID 110714163) has the molecular formula C13H10ClNOS
and a molecular weight of 263.75 g/mol. Its IUPAC name is (5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone.
Molecular Properties
| Compound Name | (5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone |
| PubChem CID | 110714163 |
| Molecular Formula | C13H10ClNOS |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | (5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C13H10ClNOS/c14-10-3-4-11-9(8-10)5-6-15(11)13(16)12-2-1-7-17-12/h1-4,7-8H,5-6H2 |
| InChIKey | ZBBWXOPDMHQDBK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone?
The IUPAC name of (5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone (CID 110714163) is (5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone.
What is the SMILES notation for (5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone?
The canonical SMILES for (5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone is O=C(c1cccs1)N1CCc2cc(Cl)ccc21.
What is the InChIKey of (5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone?
The InChIKey is ZBBWXOPDMHQDBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNOS/c14-10-3-4-11-9(8-10)5-6-15(11)13(16)12-2-1-7-17-12/h1-4,7-8H,5-6H2.
What are the key properties of (5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone?
(5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone has a molecular weight of 263.75 g/mol, XLogP of 3.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2,3-dihydroindol-1-yl)-thiophen-2-ylmethanone is sourced from PubChem (CID 110714163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).