About quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate
quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 1107142) has the molecular formula C21H20N2O4S
and a molecular weight of 396.47 g/mol. Its IUPAC name is quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate.
Molecular Properties
| Compound Name | quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate |
| PubChem CID | 1107142 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(Oc1cccc2cccnc12)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C21H20N2O4S/c24-21(27-19-11-5-7-16-9-6-12-22-20(16)19)17-8-4-10-18(15-17)28(25,26)23-13-2-1-3-14-23/h4-12,15H,1-3,13-14H2 |
| InChIKey | FKSCKADVXKOVHL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate?
The IUPAC name of quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate (CID 1107142) is quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate.
What is the SMILES notation for quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate?
The canonical SMILES for quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate is O=C(Oc1cccc2cccnc12)c1cccc(S(=O)(=O)N2CCCCC2)c1.
What is the InChIKey of quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate?
The InChIKey is FKSCKADVXKOVHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O4S/c24-21(27-19-11-5-7-16-9-6-12-22-20(16)19)17-8-4-10-18(15-17)28(25,26)23-13-2-1-3-14-23/h4-12,15H,1-3,13-14H2.
What are the key properties of quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate?
quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate has a molecular weight of 396.47 g/mol, XLogP of 3.63, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-yl 3-piperidin-1-ylsulfonylbenzoate is sourced from PubChem (CID 1107142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).