C23H18ClF6NO4 — CID 11071420
diethyl 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-phenylindolizine-1,7-dicarboxylate (PubChem CID 11071420) has the molecular formula C23H18ClF6NO4 and a molecular weight of 521.84 g/mol. Its IUPAC name is diethyl 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-phenylindolizine-1,7-dicarboxylate.
| Compound Name | diethyl 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-phenylindolizine-1,7-dicarboxylate |
|---|---|
| PubChem CID | 11071420 |
| Molecular Formula | C23H18ClF6NO4 |
| Molecular Weight | 521.84 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | diethyl 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-phenylindolizine-1,7-dicarboxylate |
| SMILES | CCOC(=O)c1ccn2c(-c3ccccc3)c(C(F)(F)C(F)(F)C(F)(F)Cl)c(C(=O)OCC)c2c1 |
| InChI | InChI=1S/C23H18ClF6NO4/c1-3-34-19(32)14-10-11-31-15(12-14)16(20(33)35-4-2)17(18(31)13-8-6-5-7-9-13)21(25,26)22(27,28)23(24,29)30/h5-12H,3-4H2,1-2H3 |
| InChIKey | HTVFHEPIRMXZPA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.84 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|