C11H11ClN2O3S — CID 110714673
4-chloro-N-[(2-methyl-1,3-oxazol-4-yl)methyl]benzenesulfonamide (PubChem CID 110714673) has the molecular formula C11H11ClN2O3S and a molecular weight of 286.74 g/mol. Its IUPAC name is 4-chloro-N-[(2-methyl-1,3-oxazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(2-methyl-1,3-oxazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110714673 |
| Molecular Formula | C11H11ClN2O3S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 4-chloro-N-[(2-methyl-1,3-oxazol-4-yl)methyl]benzenesulfonamide |
| SMILES | Cc1nc(CNS(=O)(=O)c2ccc(Cl)cc2)co1 |
| InChI | InChI=1S/C11H11ClN2O3S/c1-8-14-10(7-17-8)6-13-18(15,16)11-4-2-9(12)3-5-11/h2-5,7,13H,6H2,1H3 |
| InChIKey | CDEOUBAJPMFAOD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |