About N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide
N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide (PubChem CID 110715362) has the molecular formula C12H15N3O4S
and a molecular weight of 297.34 g/mol. Its IUPAC name is N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide.
Molecular Properties
| Compound Name | N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide |
| PubChem CID | 110715362 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(C2NC(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C12H15N3O4S/c1-3-20(18,19)14-9-6-4-8(5-7-9)10-11(16)15(2)12(17)13-10/h4-7,10,14H,3H2,1-2H3,(H,13,17) |
| InChIKey | XEAQFHFDMLZZDT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide?
The IUPAC name of N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide (CID 110715362) is N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide.
What is the SMILES notation for N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide?
The canonical SMILES for N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide is CCS(=O)(=O)Nc1ccc(C2NC(=O)N(C)C2=O)cc1.
What is the InChIKey of N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide?
The InChIKey is XEAQFHFDMLZZDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O4S/c1-3-20(18,19)14-9-6-4-8(5-7-9)10-11(16)15(2)12(17)13-10/h4-7,10,14H,3H2,1-2H3,(H,13,17).
What are the key properties of N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide?
N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide has a molecular weight of 297.34 g/mol, XLogP of 0.67, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]ethanesulfonamide is sourced from PubChem (CID 110715362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).