C36H44Si2 — CID 11071553
bis(2,4,6-trimethylphenyl)silylidene-bis(2,4,6-trimethylphenyl)silane (PubChem CID 11071553) has the molecular formula C36H44Si2 and a molecular weight of 532.92 g/mol. Its IUPAC name is bis(2,4,6-trimethylphenyl)silylidene-bis(2,4,6-trimethylphenyl)silane.
| Compound Name | bis(2,4,6-trimethylphenyl)silylidene-bis(2,4,6-trimethylphenyl)silane |
|---|---|
| PubChem CID | 11071553 |
| Molecular Formula | C36H44Si2 |
| Molecular Weight | 532.92 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | bis(2,4,6-trimethylphenyl)silylidene-bis(2,4,6-trimethylphenyl)silane |
| SMILES | Cc1cc(C)c([Si](c2c(C)cc(C)cc2C)=[Si](c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C36H44Si2/c1-21-13-25(5)33(26(6)14-21)37(34-27(7)15-22(2)16-28(34)8)38(35-29(9)17-23(3)18-30(35)10)36-31(11)19-24(4)20-32(36)12/h13-20H,1-12H3 |
| InChIKey | JZNJOOQRVMCTDU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.92 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|