C14H19N5O2S — CID 110715643
N,N-dimethyl-4-phthalazin-1-ylpiperazine-1-sulfonamide (PubChem CID 110715643) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is N,N-dimethyl-4-phthalazin-1-ylpiperazine-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-phthalazin-1-ylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 110715643 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N,N-dimethyl-4-phthalazin-1-ylpiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(c2nncc3ccccc23)CC1 |
| InChI | InChI=1S/C14H19N5O2S/c1-17(2)22(20,21)19-9-7-18(8-10-19)14-13-6-4-3-5-12(13)11-15-16-14/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | XWFLJJNDXYODMG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |