C31H54O5Si — CID 11071568
[(2R)-2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxypropyl] (1S,4aS,4bR,10aS)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthrene-1-carboxylate (PubChem CID 11071568) has the molecular formula C31H54O5Si and a molecular weight of 534.85 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxypropyl] (1S,4aS,4bR,10aS)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthrene-1-carboxylate.
| Compound Name | [(2R)-2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxypropyl] (1S,4aS,4bR,10aS)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 11071568 |
| Molecular Formula | C31H54O5Si |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | [(2R)-2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxypropyl] (1S,4aS,4bR,10aS)-2,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-1H-phenanthrene-1-carboxylate |
| SMILES | CC(=O)O[C@H](COC(=O)[C@H]1C(C)=CC[C@@H]2[C@]1(C)CCC1C(C)(C)CCC[C@]12C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H54O5Si/c1-21-13-14-25-30(8)17-12-16-29(6,7)24(30)15-18-31(25,9)26(21)27(33)34-19-23(36-22(2)32)20-35-37(10,11)28(3,4)5/h13,23-26H,12,14-20H2,1-11H3/t23-,24?,25+,26-,30-,31+/m1/s1 |
| InChIKey | PLOAPZDSIGCNFJ-IKWNHDMQSA-N |
| XLogP | 7.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|