About 4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide
4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide (PubChem CID 110715760) has the molecular formula C12H13FN2O2S2
and a molecular weight of 300.38 g/mol. Its IUPAC name is 4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide |
| PubChem CID | 110715760 |
| Molecular Formula | C12H13FN2O2S2 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)Cc2nccs2)ccc1F |
| InChI | InChI=1S/C12H13FN2O2S2/c1-9-7-10(3-4-11(9)13)19(16,17)15(2)8-12-14-5-6-18-12/h3-7H,8H2,1-2H3 |
| InChIKey | MCRKZFSRVYHVLF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide?
The IUPAC name of 4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide (CID 110715760) is 4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide.
What is the SMILES notation for 4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide?
The canonical SMILES for 4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide is Cc1cc(S(=O)(=O)N(C)Cc2nccs2)ccc1F.
What is the InChIKey of 4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide?
The InChIKey is MCRKZFSRVYHVLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O2S2/c1-9-7-10(3-4-11(9)13)19(16,17)15(2)8-12-14-5-6-18-12/h3-7H,8H2,1-2H3.
What are the key properties of 4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide?
4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide has a molecular weight of 300.38 g/mol, XLogP of 2.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N,3-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide is sourced from PubChem (CID 110715760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).